C31H52N8O7 — CID 166942045
N-(3-azidopropyl)-2-[(11R,17S)-9,22,28-trioxo-10,21,29-trioxa-1,4,7,24-tetrazatetracyclo[15.9.3.27,24.211,20]tritriacontan-4-yl]acetamide (PubChem CID 166942045) has the molecular formula C31H52N8O7 and a molecular weight of 648.81 g/mol. Its IUPAC name is N-(3-azidopropyl)-2-[(11R,17S)-9,22,28-trioxo-10,21,29-trioxa-1,4,7,24-tetrazatetracyclo[15.9.3.27,24.211,20]tritriacontan-4-yl]acetamide.
| Compound Name | N-(3-azidopropyl)-2-[(11R,17S)-9,22,28-trioxo-10,21,29-trioxa-1,4,7,24-tetrazatetracyclo[15.9.3.27,24.211,20]tritriacontan-4-yl]acetamide |
|---|---|
| PubChem CID | 166942045 |
| Molecular Formula | C31H52N8O7 |
| Molecular Weight | 648.81 g/mol |
| Exact Mass | 648.40 |
| IUPAC Name | N-(3-azidopropyl)-2-[(11R,17S)-9,22,28-trioxo-10,21,29-trioxa-1,4,7,24-tetrazatetracyclo[15.9.3.27,24.211,20]tritriacontan-4-yl]acetamide |
| SMILES | [N-]=[N+]=NCCCNC(=O)CN1CCN2CCN3CCN(CC1)CC(=O)O[C@H]1CCCCC[C@H](CCC(CC1)OC(=O)C3)OC(=O)C2 |
| InChI | InChI=1S/C31H52N8O7/c32-35-34-12-4-11-33-28(40)21-36-13-15-37-17-19-39-20-18-38(16-14-36)23-30(42)45-26-6-3-1-2-5-25(44-29(41)22-37)7-9-27(10-8-26)46-31(43)24-39/h25-27H,1-24H2,(H,33,40)/t25-,26+,27? |
| InChIKey | QZXRHTBXMGGYSU-ZVBBVAIHSA-N |
| XLogP | 1.31 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.81 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|