C19H32N6O6 — CID 155069945
2-[4-[3-(5-azidopentanoylamino)propanoyl]-2-(2-methylpropanoyloxymethyl)piperazin-1-yl]acetic acid (PubChem CID 155069945) has the molecular formula C19H32N6O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-[4-[3-(5-azidopentanoylamino)propanoyl]-2-(2-methylpropanoyloxymethyl)piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[3-(5-azidopentanoylamino)propanoyl]-2-(2-methylpropanoyloxymethyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 155069945 |
| Molecular Formula | C19H32N6O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 2-[4-[3-(5-azidopentanoylamino)propanoyl]-2-(2-methylpropanoyloxymethyl)piperazin-1-yl]acetic acid |
| SMILES | CC(C)C(=O)OCC1CN(C(=O)CCNC(=O)CCCCN=[N+]=[N-])CCN1CC(=O)O |
| InChI | InChI=1S/C19H32N6O6/c1-14(2)19(30)31-13-15-11-25(10-9-24(15)12-18(28)29)17(27)6-8-21-16(26)5-3-4-7-22-23-20/h14-15H,3-13H2,1-2H3,(H,21,26)(H,28,29) |
| InChIKey | KUJGAFZRCNRBCG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 165.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|