C25H27ClF3N3O2 — CID 155351641
1-acetyl-N-[7-chloro-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-2,3-dihydroindol-5-yl]piperidine-2-carboxamide (PubChem CID 155351641) has the molecular formula C25H27ClF3N3O2 and a molecular weight of 493.96 g/mol. Its IUPAC name is 1-acetyl-N-[7-chloro-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-2,3-dihydroindol-5-yl]piperidine-2-carboxamide.
| Compound Name | 1-acetyl-N-[7-chloro-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-2,3-dihydroindol-5-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 155351641 |
| Molecular Formula | C25H27ClF3N3O2 |
| Molecular Weight | 493.96 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 1-acetyl-N-[7-chloro-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-2,3-dihydroindol-5-yl]piperidine-2-carboxamide |
| SMILES | CC(=O)N1CCCCC1C(=O)Nc1cc(Cl)c2c(c1)CCN2CCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H27ClF3N3O2/c1-16(33)32-11-3-2-4-22(32)24(34)30-20-14-18-10-13-31(23(18)21(26)15-20)12-9-17-5-7-19(8-6-17)25(27,28)29/h5-8,14-15,22H,2-4,9-13H2,1H3,(H,30,34) |
| InChIKey | DHGPCJDMERWGRZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.96 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|