C22H30F3N3O — CID 155353320
4-(2-cyclohexylethyl)-N-methylidene-N'-(pyrrolidin-2-ylmethoxy)-3-(trifluoromethyl)benzenecarboximidamide (PubChem CID 155353320) has the molecular formula C22H30F3N3O and a molecular weight of 409.50 g/mol. Its IUPAC name is 4-(2-cyclohexylethyl)-N-methylidene-N'-(pyrrolidin-2-ylmethoxy)-3-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 4-(2-cyclohexylethyl)-N-methylidene-N'-(pyrrolidin-2-ylmethoxy)-3-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 155353320 |
| Molecular Formula | C22H30F3N3O |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 4-(2-cyclohexylethyl)-N-methylidene-N'-(pyrrolidin-2-ylmethoxy)-3-(trifluoromethyl)benzenecarboximidamide |
| SMILES | C=N/C(=N\OCC1CCCN1)c1ccc(CCC2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H30F3N3O/c1-26-21(28-29-15-19-8-5-13-27-19)18-12-11-17(20(14-18)22(23,24)25)10-9-16-6-3-2-4-7-16/h11-12,14,16,19,27H,1-10,13,15H2/b28-21- |
| InChIKey | NDFYFGRMHQDNEI-HFTWOUSFSA-N |
| XLogP | 5.35 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|