C24H32F3N3O2 — CID 155353285
4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-N-methylidene-N'-(pyrrolidin-2-ylmethoxy)-3-(trifluoromethyl)benzenecarboximidamide (PubChem CID 155353285) has the molecular formula C24H32F3N3O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-N-methylidene-N'-(pyrrolidin-2-ylmethoxy)-3-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-N-methylidene-N'-(pyrrolidin-2-ylmethoxy)-3-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 155353285 |
| Molecular Formula | C24H32F3N3O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-N-methylidene-N'-(pyrrolidin-2-ylmethoxy)-3-(trifluoromethyl)benzenecarboximidamide |
| SMILES | C=N/C(=N\OCC1CCCN1)c1ccc(OC/C=C(\C)CCC=C(C)C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H32F3N3O2/c1-17(2)7-5-8-18(3)12-14-31-22-11-10-19(15-21(22)24(25,26)27)23(28-4)30-32-16-20-9-6-13-29-20/h7,10-12,15,20,29H,4-6,8-9,13-14,16H2,1-3H3/b18-12+,30-23- |
| InChIKey | KYKDOSUHNLAHRY-ZXNCSDEWSA-N |
| XLogP | 5.91 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|