C12H21NO — CID 155354807
1-(2,4-dimethylpentan-3-yl)-3-methylidenepyrrolidin-2-one (PubChem CID 155354807) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(2,4-dimethylpentan-3-yl)-3-methylidenepyrrolidin-2-one.
| Compound Name | 1-(2,4-dimethylpentan-3-yl)-3-methylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 155354807 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-(2,4-dimethylpentan-3-yl)-3-methylidenepyrrolidin-2-one |
| SMILES | C=C1CCN(C(C(C)C)C(C)C)C1=O |
| InChI | InChI=1S/C12H21NO/c1-8(2)11(9(3)4)13-7-6-10(5)12(13)14/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | OWJIEMPLJZZWIF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|