C10H19NO — CID 592965
N,N-diethyl-3-methyl-2-methylidenebutanamide (PubChem CID 592965) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is N,N-diethyl-3-methyl-2-methylidenebutanamide.
| Compound Name | N,N-diethyl-3-methyl-2-methylidenebutanamide |
|---|---|
| PubChem CID | 592965 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N,N-diethyl-3-methyl-2-methylidenebutanamide |
| SMILES | C=C(C(=O)N(CC)CC)C(C)C |
| InChI | InChI=1S/C10H19NO/c1-6-11(7-2)10(12)9(5)8(3)4/h8H,5-7H2,1-4H3 |
| InChIKey | MLVYUTUBSSVUFX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|