C14H19NO — CID 135070598
3,5-bis(ethenyl)-1-(3-methyl-2-methylidenebut-3-enyl)pyrrolidin-2-one (PubChem CID 135070598) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 3,5-bis(ethenyl)-1-(3-methyl-2-methylidenebut-3-enyl)pyrrolidin-2-one.
| Compound Name | 3,5-bis(ethenyl)-1-(3-methyl-2-methylidenebut-3-enyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 135070598 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3,5-bis(ethenyl)-1-(3-methyl-2-methylidenebut-3-enyl)pyrrolidin-2-one |
| SMILES | C=CC1CC(C=C)N(CC(=C)C(=C)C)C1=O |
| InChI | InChI=1S/C14H19NO/c1-6-12-8-13(7-2)15(14(12)16)9-11(5)10(3)4/h6-7,12-13H,1-3,5,8-9H2,4H3 |
| InChIKey | GPLHZDMCQVUBDU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|