C16H28N2O7S — CID 174577966
2-(dimethylamino)ethyl 2-[(3-ethenyl-2-oxopyrrolidin-1-yl)methyl]prop-2-enoate;dimethyl sulfate (PubChem CID 174577966) has the molecular formula C16H28N2O7S and a molecular weight of 392.47 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-[(3-ethenyl-2-oxopyrrolidin-1-yl)methyl]prop-2-enoate;dimethyl sulfate.
| Compound Name | 2-(dimethylamino)ethyl 2-[(3-ethenyl-2-oxopyrrolidin-1-yl)methyl]prop-2-enoate;dimethyl sulfate |
|---|---|
| PubChem CID | 174577966 |
| Molecular Formula | C16H28N2O7S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-[(3-ethenyl-2-oxopyrrolidin-1-yl)methyl]prop-2-enoate;dimethyl sulfate |
| SMILES | C=CC1CCN(CC(=C)C(=O)OCCN(C)C)C1=O.COS(=O)(=O)OC |
| InChI | InChI=1S/C14H22N2O3.C2H6O4S/c1-5-12-6-7-16(13(12)17)10-11(2)14(18)19-9-8-15(3)4;1-5-7(3,4)6-2/h5,12H,1-2,6-10H2,3-4H3;1-2H3 |
| InChIKey | GZNFELOPPXXFLD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|