C16H32N2O6S — CID 87532529
2-(dimethylamino)ethyl 2-methylprop-2-enoate;dimethyl sulfate;1-ethenylpyrrolidine (PubChem CID 87532529) has the molecular formula C16H32N2O6S and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;dimethyl sulfate;1-ethenylpyrrolidine.
| Compound Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;dimethyl sulfate;1-ethenylpyrrolidine |
|---|---|
| PubChem CID | 87532529 |
| Molecular Formula | C16H32N2O6S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;dimethyl sulfate;1-ethenylpyrrolidine |
| SMILES | C=C(C)C(=O)OCCN(C)C.C=CN1CCCC1.COS(=O)(=O)OC |
| InChI | InChI=1S/C8H15NO2.C6H11N.C2H6O4S/c1-7(2)8(10)11-6-5-9(3)4;1-2-7-5-3-4-6-7;1-5-7(3,4)6-2/h1,5-6H2,2-4H3;2H,1,3-6H2;1-2H3 |
| InChIKey | VRMBVZTWDCCBOG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|