C25H37NO9 — CID 70559340
2-[2-[1-(3-ethenyl-2-oxopyrrolidin-1-yl)-2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate (PubChem CID 70559340) has the molecular formula C25H37NO9 and a molecular weight of 495.57 g/mol. Its IUPAC name is 2-[2-[1-(3-ethenyl-2-oxopyrrolidin-1-yl)-2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[1-(3-ethenyl-2-oxopyrrolidin-1-yl)-2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70559340 |
| Molecular Formula | C25H37NO9 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 2-[2-[1-(3-ethenyl-2-oxopyrrolidin-1-yl)-2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=CC1CCN(C(COC(=O)C(=C)C)OCCOCCOC(=O)C(=C)C)C1=O |
| InChI | InChI=1S/C20H29NO7.C5H8O2/c1-6-16-7-8-21(18(16)22)17(13-28-20(24)15(4)5)26-11-9-25-10-12-27-19(23)14(2)3;1-4(2)5(6)7-3/h6,16-17H,1-2,4,7-13H2,3,5H3;1H2,2-3H3 |
| InChIKey | ZZMDURPKXUFLLJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|