C14H21NOSi — CID 102349825
(2R,8aS)-2-ethenyl-6-methylidene-7-trimethylsilyl-1,2,5,8a-tetrahydroindolizin-3-one (PubChem CID 102349825) has the molecular formula C14H21NOSi and a molecular weight of 247.41 g/mol. Its IUPAC name is (2R,8aS)-2-ethenyl-6-methylidene-7-trimethylsilyl-1,2,5,8a-tetrahydroindolizin-3-one.
| Compound Name | (2R,8aS)-2-ethenyl-6-methylidene-7-trimethylsilyl-1,2,5,8a-tetrahydroindolizin-3-one |
|---|---|
| PubChem CID | 102349825 |
| Molecular Formula | C14H21NOSi |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (2R,8aS)-2-ethenyl-6-methylidene-7-trimethylsilyl-1,2,5,8a-tetrahydroindolizin-3-one |
| SMILES | C=C[C@H]1C[C@H]2C=C([Si](C)(C)C)C(=C)CN2C1=O |
| InChI | InChI=1S/C14H21NOSi/c1-6-11-7-12-8-13(17(3,4)5)10(2)9-15(12)14(11)16/h6,8,11-12H,1-2,7,9H2,3-5H3/t11-,12-/m0/s1 |
| InChIKey | JEGAJHDBWHOSRQ-RYUDHWBXSA-N |
| XLogP | 2.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|