C15H21NO — CID 102353970
(3R,5S)-3,5-bis(ethenyl)-1-(4-methylidenehex-5-enyl)pyrrolidin-2-one (PubChem CID 102353970) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (3R,5S)-3,5-bis(ethenyl)-1-(4-methylidenehex-5-enyl)pyrrolidin-2-one.
| Compound Name | (3R,5S)-3,5-bis(ethenyl)-1-(4-methylidenehex-5-enyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 102353970 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (3R,5S)-3,5-bis(ethenyl)-1-(4-methylidenehex-5-enyl)pyrrolidin-2-one |
| SMILES | C=CC(=C)CCCN1C(=O)[C@@H](C=C)C[C@H]1C=C |
| InChI | InChI=1S/C15H21NO/c1-5-12(4)9-8-10-16-14(7-3)11-13(6-2)15(16)17/h5-7,13-14H,1-4,8-11H2/t13-,14+/m0/s1 |
| InChIKey | WHZAFEKZMDGJTJ-UONOGXRCSA-N |
| XLogP | 3.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|