C18H26N2O — CID 143913844
3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one (PubChem CID 143913844) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one.
| Compound Name | 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one |
|---|---|
| PubChem CID | 143913844 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3,5-dimethyl-1-(3-methylidenepent-4-enyl)-6-(pyrrolidin-1-ylmethyl)pyridin-2-one |
| SMILES | C=CC(=C)CCn1c(CN2CCCC2)c(C)cc(C)c1=O |
| InChI | InChI=1S/C18H26N2O/c1-5-14(2)8-11-20-17(13-19-9-6-7-10-19)15(3)12-16(4)18(20)21/h5,12H,1-2,6-11,13H2,3-4H3 |
| InChIKey | VMKDBDWALXKQTE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|