C21H22N6O2S — CID 155356453
3-[[4-[[(4-aminophenyl)sulfanylamino]methyl]phenyl]methyl]-7-ethylpurine-2,6-dione (PubChem CID 155356453) has the molecular formula C21H22N6O2S and a molecular weight of 422.51 g/mol. Its IUPAC name is 3-[[4-[[(4-aminophenyl)sulfanylamino]methyl]phenyl]methyl]-7-ethylpurine-2,6-dione.
| Compound Name | 3-[[4-[[(4-aminophenyl)sulfanylamino]methyl]phenyl]methyl]-7-ethylpurine-2,6-dione |
|---|---|
| PubChem CID | 155356453 |
| Molecular Formula | C21H22N6O2S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 3-[[4-[[(4-aminophenyl)sulfanylamino]methyl]phenyl]methyl]-7-ethylpurine-2,6-dione |
| SMILES | CCn1cnc2c1c(=O)[nH]c(=O)n2Cc1ccc(CNSc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C21H22N6O2S/c1-2-26-13-23-19-18(26)20(28)25-21(29)27(19)12-15-5-3-14(4-6-15)11-24-30-17-9-7-16(22)8-10-17/h3-10,13,24H,2,11-12,22H2,1H3,(H,25,28,29) |
| InChIKey | YMNDQTHHMIDLHT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|