C23H24N6O5S — CID 142577864
N-[3-[[4-[(7-ethyl-2,6-dioxopurin-3-yl)methyl]phenyl]methylsulfamoyl]phenyl]acetamide (PubChem CID 142577864) has the molecular formula C23H24N6O5S and a molecular weight of 496.55 g/mol. Its IUPAC name is N-[3-[[4-[(7-ethyl-2,6-dioxopurin-3-yl)methyl]phenyl]methylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[3-[[4-[(7-ethyl-2,6-dioxopurin-3-yl)methyl]phenyl]methylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 142577864 |
| Molecular Formula | C23H24N6O5S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N-[3-[[4-[(7-ethyl-2,6-dioxopurin-3-yl)methyl]phenyl]methylsulfamoyl]phenyl]acetamide |
| SMILES | CCn1cnc2c1c(=O)[nH]c(=O)n2Cc1ccc(CNS(=O)(=O)c2cccc(NC(C)=O)c2)cc1 |
| InChI | InChI=1S/C23H24N6O5S/c1-3-28-14-24-21-20(28)22(31)27-23(32)29(21)13-17-9-7-16(8-10-17)12-25-35(33,34)19-6-4-5-18(11-19)26-15(2)30/h4-11,14,25H,3,12-13H2,1-2H3,(H,26,30)(H,27,31,32) |
| InChIKey | LUKUOCNEOZUKTC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |