C28H32BrNO3 — CID 15536182
(3S,4R)-3-[[(1S,3R,4R,6R)-4-bromo-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]oxy]-1-(4-methoxyphenyl)-4-[(E)-2-phenylethenyl]azetidin-2-one (PubChem CID 15536182) has the molecular formula C28H32BrNO3 and a molecular weight of 510.47 g/mol. Its IUPAC name is (3S,4R)-3-[[(1S,3R,4R,6R)-4-bromo-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]oxy]-1-(4-methoxyphenyl)-4-[(E)-2-phenylethenyl]azetidin-2-one.
| Compound Name | (3S,4R)-3-[[(1S,3R,4R,6R)-4-bromo-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]oxy]-1-(4-methoxyphenyl)-4-[(E)-2-phenylethenyl]azetidin-2-one |
|---|---|
| PubChem CID | 15536182 |
| Molecular Formula | C28H32BrNO3 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | (3S,4R)-3-[[(1S,3R,4R,6R)-4-bromo-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]oxy]-1-(4-methoxyphenyl)-4-[(E)-2-phenylethenyl]azetidin-2-one |
| SMILES | COc1ccc(N2C(=O)[C@@H](O[C@]3(C)C[C@H]4[C@@H](C[C@H]3Br)C4(C)C)[C@H]2/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C28H32BrNO3/c1-27(2)21-16-24(29)28(3,17-22(21)27)33-25-23(15-10-18-8-6-5-7-9-18)30(26(25)31)19-11-13-20(32-4)14-12-19/h5-15,21-25H,16-17H2,1-4H3/b15-10+/t21-,22+,23-,24-,25+,28-/m1/s1 |
| InChIKey | SQZHJZJQSXOGPS-VXSPCXMISA-N |
| XLogP | 6.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|