C23H28BrNO2 — CID 101164780
(3S,4R)-3-[[(1S,3R,4R,6R)-4-bromo-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]oxy]-1-ethenyl-4-[(E)-2-phenylethenyl]azetidin-2-one (PubChem CID 101164780) has the molecular formula C23H28BrNO2 and a molecular weight of 430.39 g/mol. Its IUPAC name is (3S,4R)-3-[[(1S,3R,4R,6R)-4-bromo-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]oxy]-1-ethenyl-4-[(E)-2-phenylethenyl]azetidin-2-one.
| Compound Name | (3S,4R)-3-[[(1S,3R,4R,6R)-4-bromo-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]oxy]-1-ethenyl-4-[(E)-2-phenylethenyl]azetidin-2-one |
|---|---|
| PubChem CID | 101164780 |
| Molecular Formula | C23H28BrNO2 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (3S,4R)-3-[[(1S,3R,4R,6R)-4-bromo-3,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]oxy]-1-ethenyl-4-[(E)-2-phenylethenyl]azetidin-2-one |
| SMILES | C=CN1C(=O)[C@@H](O[C@]2(C)C[C@H]3[C@@H](C[C@H]2Br)C3(C)C)[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H28BrNO2/c1-5-25-18(12-11-15-9-7-6-8-10-15)20(21(25)26)27-23(4)14-17-16(13-19(23)24)22(17,2)3/h5-12,16-20H,1,13-14H2,2-4H3/b12-11+/t16-,17+,18-,19-,20+,23-/m1/s1 |
| InChIKey | LRNGSUAZUOONGH-ZQPPDCIHSA-N |
| XLogP | 5.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|