C30H33N7O3 — CID 155362796
4-ethyl-6-[3-oxo-2-prop-2-enyl-6-[(1,1,2-trimethyl-3,4-dihydroisoquinolin-7-yl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-1,4-benzoxazin-3-one (PubChem CID 155362796) has the molecular formula C30H33N7O3 and a molecular weight of 539.64 g/mol. Its IUPAC name is 4-ethyl-6-[3-oxo-2-prop-2-enyl-6-[(1,1,2-trimethyl-3,4-dihydroisoquinolin-7-yl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-1,4-benzoxazin-3-one.
| Compound Name | 4-ethyl-6-[3-oxo-2-prop-2-enyl-6-[(1,1,2-trimethyl-3,4-dihydroisoquinolin-7-yl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 155362796 |
| Molecular Formula | C30H33N7O3 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 4-ethyl-6-[3-oxo-2-prop-2-enyl-6-[(1,1,2-trimethyl-3,4-dihydroisoquinolin-7-yl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-1,4-benzoxazin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc4c(c3)C(C)(C)N(C)CC4)nc2n1-c1ccc2c(c1)N(CC)C(=O)CO2 |
| InChI | InChI=1S/C30H33N7O3/c1-6-13-36-28(39)22-17-31-29(32-20-9-8-19-12-14-34(5)30(3,4)23(19)15-20)33-27(22)37(36)21-10-11-25-24(16-21)35(7-2)26(38)18-40-25/h6,8-11,15-17H,1,7,12-14,18H2,2-5H3,(H,31,32,33) |
| InChIKey | DLIDFSGVCTZNDR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|