C20H25F2NO2 — CID 155367711
3-fluoro-5-(2-fluoro-4-nonylphenyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 155367711) has the molecular formula C20H25F2NO2 and a molecular weight of 349.42 g/mol. Its IUPAC name is 3-fluoro-5-(2-fluoro-4-nonylphenyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-fluoro-5-(2-fluoro-4-nonylphenyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 155367711 |
| Molecular Formula | C20H25F2NO2 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-fluoro-5-(2-fluoro-4-nonylphenyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | CCCCCCCCCc1ccc(-c2cc(F)c(C(=O)O)[nH]2)c(F)c1 |
| InChI | InChI=1S/C20H25F2NO2/c1-2-3-4-5-6-7-8-9-14-10-11-15(16(21)12-14)18-13-17(22)19(23-18)20(24)25/h10-13,23H,2-9H2,1H3,(H,24,25) |
| InChIKey | FTVBGRGOSATZTP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|