C24H41NO7 — CID 155368010
1-(2-methoxyethoxycarbonyloxy)ethyl 1-(9-butoxynonyl)pyrrole-3-carboxylate (PubChem CID 155368010) has the molecular formula C24H41NO7 and a molecular weight of 455.59 g/mol. Its IUPAC name is 1-(2-methoxyethoxycarbonyloxy)ethyl 1-(9-butoxynonyl)pyrrole-3-carboxylate.
| Compound Name | 1-(2-methoxyethoxycarbonyloxy)ethyl 1-(9-butoxynonyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 155368010 |
| Molecular Formula | C24H41NO7 |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 1-(2-methoxyethoxycarbonyloxy)ethyl 1-(9-butoxynonyl)pyrrole-3-carboxylate |
| SMILES | CCCCOCCCCCCCCCn1ccc(C(=O)OC(C)OC(=O)OCCOC)c1 |
| InChI | InChI=1S/C24H41NO7/c1-4-5-16-29-17-12-10-8-6-7-9-11-14-25-15-13-22(20-25)23(26)31-21(2)32-24(27)30-19-18-28-3/h13,15,20-21H,4-12,14,16-19H2,1-3H3 |
| InChIKey | SSKUASFMVBVRKQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 85.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|