C14H13ClF3NO2 — CID 155368730
5-chloro-2-(2-cyclopropylethyl)-7-(trifluoromethoxy)-3H-isoindol-1-one (PubChem CID 155368730) has the molecular formula C14H13ClF3NO2 and a molecular weight of 319.71 g/mol. Its IUPAC name is 5-chloro-2-(2-cyclopropylethyl)-7-(trifluoromethoxy)-3H-isoindol-1-one.
| Compound Name | 5-chloro-2-(2-cyclopropylethyl)-7-(trifluoromethoxy)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 155368730 |
| Molecular Formula | C14H13ClF3NO2 |
| Molecular Weight | 319.71 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 5-chloro-2-(2-cyclopropylethyl)-7-(trifluoromethoxy)-3H-isoindol-1-one |
| SMILES | O=C1c2c(cc(Cl)cc2OC(F)(F)F)CN1CCC1CC1 |
| InChI | InChI=1S/C14H13ClF3NO2/c15-10-5-9-7-19(4-3-8-1-2-8)13(20)12(9)11(6-10)21-14(16,17)18/h5-6,8H,1-4,7H2 |
| InChIKey | FDMFAOVAGQQVSJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.71 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |