C30H24FN5O5S — CID 155369343
1-N'-(4-fluorophenyl)-1-N-[4-[7-(1-methylsulfonylpyrazol-4-yl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 155369343) has the molecular formula C30H24FN5O5S and a molecular weight of 585.62 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-[4-[7-(1-methylsulfonylpyrazol-4-yl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-[4-[7-(1-methylsulfonylpyrazol-4-yl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 155369343 |
| Molecular Formula | C30H24FN5O5S |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-[4-[7-(1-methylsulfonylpyrazol-4-yl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | CS(=O)(=O)n1cc(-c2ccc3c(Oc4ccc(NC(=O)C5(C(=O)Nc6ccc(F)cc6)CC5)cc4)ccnc3c2)cn1 |
| InChI | InChI=1S/C30H24FN5O5S/c1-42(39,40)36-18-20(17-33-36)19-2-11-25-26(16-19)32-15-12-27(25)41-24-9-7-23(8-10-24)35-29(38)30(13-14-30)28(37)34-22-5-3-21(31)4-6-22/h2-12,15-18H,13-14H2,1H3,(H,34,37)(H,35,38) |
| InChIKey | OEZYNNSWJMKKCR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|