C29H23FN6O3 — CID 155369063
1-N'-(4-fluorophenyl)-1-N-[4-[7-(2-methyltriazol-4-yl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 155369063) has the molecular formula C29H23FN6O3 and a molecular weight of 522.54 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-[4-[7-(2-methyltriazol-4-yl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-[4-[7-(2-methyltriazol-4-yl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 155369063 |
| Molecular Formula | C29H23FN6O3 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-[4-[7-(2-methyltriazol-4-yl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cn1ncc(-c2ccc3c(Oc4ccc(NC(=O)C5(C(=O)Nc6ccc(F)cc6)CC5)cc4)ccnc3c2)n1 |
| InChI | InChI=1S/C29H23FN6O3/c1-36-32-17-25(35-36)18-2-11-23-24(16-18)31-15-12-26(23)39-22-9-7-21(8-10-22)34-28(38)29(13-14-29)27(37)33-20-5-3-19(30)4-6-20/h2-12,15-17H,13-14H2,1H3,(H,33,37)(H,34,38) |
| InChIKey | XVBKQCFXCOSCFE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|