C31H24F3N5O3 — CID 155735207
1-N-phenyl-1-N'-[4-[7-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 155735207) has the molecular formula C31H24F3N5O3 and a molecular weight of 571.56 g/mol. Its IUPAC name is 1-N-phenyl-1-N'-[4-[7-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-phenyl-1-N'-[4-[7-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 155735207 |
| Molecular Formula | C31H24F3N5O3 |
| Molecular Weight | 571.56 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 1-N-phenyl-1-N'-[4-[7-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)C1(C(=O)Nc2ccc(Oc3ccnc4cc(-c5cnn(CC(F)(F)F)c5)ccc34)cc2)CC1 |
| InChI | InChI=1S/C31H24F3N5O3/c32-31(33,34)19-39-18-21(17-36-39)20-6-11-25-26(16-20)35-15-12-27(25)42-24-9-7-23(8-10-24)38-29(41)30(13-14-30)28(40)37-22-4-2-1-3-5-22/h1-12,15-18H,13-14,19H2,(H,37,40)(H,38,41) |
| InChIKey | NJHYFPGOFJBNQE-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.56 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|