C22H36Si4 — CID 15536971
[1,8-bis(trimethylsilyl)-3-(2-trimethylsilylethynyl)oct-3-en-1,5,7-triyn-4-yl]-trimethylsilane (PubChem CID 15536971) has the molecular formula C22H36Si4 and a molecular weight of 412.87 g/mol. Its IUPAC name is [1,8-bis(trimethylsilyl)-3-(2-trimethylsilylethynyl)oct-3-en-1,5,7-triyn-4-yl]-trimethylsilane.
| Compound Name | [1,8-bis(trimethylsilyl)-3-(2-trimethylsilylethynyl)oct-3-en-1,5,7-triyn-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 15536971 |
| Molecular Formula | C22H36Si4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | [1,8-bis(trimethylsilyl)-3-(2-trimethylsilylethynyl)oct-3-en-1,5,7-triyn-4-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC#CC(=C(C#C[Si](C)(C)C)C#C[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C22H36Si4/c1-23(2,3)18-14-13-15-22(26(10,11)12)21(16-19-24(4,5)6)17-20-25(7,8)9/h1-12H3 |
| InChIKey | BHCUWJPTAPOBMR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|