C14H25N — CID 155372123
N-[(3Z,5Z)-3,5-dimethylocta-3,5-dien-2-yl]butan-1-imine (PubChem CID 155372123) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is N-[(3Z,5Z)-3,5-dimethylocta-3,5-dien-2-yl]butan-1-imine.
| Compound Name | N-[(3Z,5Z)-3,5-dimethylocta-3,5-dien-2-yl]butan-1-imine |
|---|---|
| PubChem CID | 155372123 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-[(3Z,5Z)-3,5-dimethylocta-3,5-dien-2-yl]butan-1-imine |
| SMILES | CC/C=C(C)\C=C(\C)C(C)/N=C/CCC |
| InChI | InChI=1S/C14H25N/c1-6-8-10-15-14(5)13(4)11-12(3)9-7-2/h9-11,14H,6-8H2,1-5H3/b12-9-,13-11-,15-10+ |
| InChIKey | ZPGDVJMGCILHBW-OMUHXTGLSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|