C10H11N — CID 58797905
3-methyl-3,8a-dihydroquinoline (PubChem CID 58797905) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 3-methyl-3,8a-dihydroquinoline.
| Compound Name | 3-methyl-3,8a-dihydroquinoline |
|---|---|
| PubChem CID | 58797905 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3-methyl-3,8a-dihydroquinoline |
| SMILES | CC1C=NC2C=CC=CC2=C1 |
| InChI | InChI=1S/C10H11N/c1-8-6-9-4-2-3-5-10(9)11-7-8/h2-8,10H,1H3 |
| InChIKey | RQGBGYQNMGWQRV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |