C19H28N4O7 — CID 155373188
(2R)-2-hydroxy-3-[[2-[(E)-N'-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]carbamimidoyl]-1,3-dihydroisoindol-5-yl]oxy]propanoic acid (PubChem CID 155373188) has the molecular formula C19H28N4O7 and a molecular weight of 424.45 g/mol. Its IUPAC name is (2R)-2-hydroxy-3-[[2-[(E)-N'-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]carbamimidoyl]-1,3-dihydroisoindol-5-yl]oxy]propanoic acid.
| Compound Name | (2R)-2-hydroxy-3-[[2-[(E)-N'-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]carbamimidoyl]-1,3-dihydroisoindol-5-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 155373188 |
| Molecular Formula | C19H28N4O7 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (2R)-2-hydroxy-3-[[2-[(E)-N'-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]carbamimidoyl]-1,3-dihydroisoindol-5-yl]oxy]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCO/N=C(\N)N1Cc2ccc(OC[C@@H](O)C(=O)O)cc2C1 |
| InChI | InChI=1S/C19H28N4O7/c1-19(2,3)30-18(27)21-6-7-29-22-17(20)23-9-12-4-5-14(8-13(12)10-23)28-11-15(24)16(25)26/h4-5,8,15,24H,6-7,9-11H2,1-3H3,(H2,20,22)(H,21,27)(H,25,26)/t15-/m1/s1 |
| InChIKey | CNKXAQHGTDMJEK-OAHLLOKOSA-N |
| XLogP | 0.60 |
| TPSA | 155.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|