C34H54O6 — CID 155377116
[(3S,10S,13R,14R,17R)-17-[(2S)-3-acetyloxy-6-hydroxy-6-methyl-5-oxoheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 155377116) has the molecular formula C34H54O6 and a molecular weight of 558.80 g/mol. Its IUPAC name is [(3S,10S,13R,14R,17R)-17-[(2S)-3-acetyloxy-6-hydroxy-6-methyl-5-oxoheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,10S,13R,14R,17R)-17-[(2S)-3-acetyloxy-6-hydroxy-6-methyl-5-oxoheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 155377116 |
| Molecular Formula | C34H54O6 |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | [(3S,10S,13R,14R,17R)-17-[(2S)-3-acetyloxy-6-hydroxy-6-methyl-5-oxoheptan-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC(CC(=O)C(C)(C)O)[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](OC(C)=O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C34H54O6/c1-20(26(39-21(2)35)19-28(37)31(6,7)38)23-13-17-34(10)25-11-12-27-30(4,5)29(40-22(3)36)15-16-32(27,8)24(25)14-18-33(23,34)9/h20,23,26-27,29,38H,11-19H2,1-10H3/t20-,23+,26?,27?,29-,32+,33+,34-/m0/s1 |
| InChIKey | QOQDZTBBPHIABU-GCYACBEOSA-N |
| XLogP | 6.97 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|