C35H56O5 — CID 155377128
[(3S,10S,13R,14S,17R)-17-[(2S,3S)-3-acetyloxy-6-hydroxy-6-methylheptan-2-yl]-14-ethenyl-4,4,10,13-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 155377128) has the molecular formula C35H56O5 and a molecular weight of 556.83 g/mol. Its IUPAC name is [(3S,10S,13R,14S,17R)-17-[(2S,3S)-3-acetyloxy-6-hydroxy-6-methylheptan-2-yl]-14-ethenyl-4,4,10,13-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,10S,13R,14S,17R)-17-[(2S,3S)-3-acetyloxy-6-hydroxy-6-methylheptan-2-yl]-14-ethenyl-4,4,10,13-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 155377128 |
| Molecular Formula | C35H56O5 |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | [(3S,10S,13R,14S,17R)-17-[(2S,3S)-3-acetyloxy-6-hydroxy-6-methylheptan-2-yl]-14-ethenyl-4,4,10,13-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | C=C[C@@]12CC[C@H]([C@H](C)[C@H](CCC(C)(C)O)OC(C)=O)[C@@]1(C)CCC1=C2CCC2C(C)(C)[C@@H](OC(C)=O)CC[C@]12C |
| InChI | InChI=1S/C35H56O5/c1-11-35-21-15-25(22(2)28(39-23(3)36)16-18-31(5,6)38)34(35,10)20-14-26-27(35)12-13-29-32(7,8)30(40-24(4)37)17-19-33(26,29)9/h11,22,25,28-30,38H,1,12-21H2,2-10H3/t22-,25+,28-,29?,30-,33+,34+,35-/m0/s1 |
| InChIKey | NMQGJYBEMQUAOU-ZPYKTTLPSA-N |
| XLogP | 7.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|