C21H35NO3SSi — CID 15537762
N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxyhexa-3,4-dien-2-yl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 15537762) has the molecular formula C21H35NO3SSi and a molecular weight of 409.67 g/mol. Its IUPAC name is N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxyhexa-3,4-dien-2-yl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxyhexa-3,4-dien-2-yl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 15537762 |
| Molecular Formula | C21H35NO3SSi |
| Molecular Weight | 409.67 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxyhexa-3,4-dien-2-yl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | CC=C=C[C@H](CO[Si](C)(C)C(C)(C)C)NS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C21H35NO3SSi/c1-10-11-12-19(15-25-27(8,9)21(5,6)7)22-26(23,24)20-17(3)13-16(2)14-18(20)4/h10,12-14,19,22H,15H2,1-9H3/t11?,19-/m1/s1 |
| InChIKey | CPAWTAHRXMKDDJ-IMFVZPHKSA-N |
| XLogP | 5.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|