C16H27F2NO3SSi — CID 91267901
N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,4-bis(fluoromethyl)benzenesulfonamide (PubChem CID 91267901) has the molecular formula C16H27F2NO3SSi and a molecular weight of 379.55 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,4-bis(fluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,4-bis(fluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91267901 |
| Molecular Formula | C16H27F2NO3SSi |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,4-bis(fluoromethyl)benzenesulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCNS(=O)(=O)c1ccc(CF)cc1CF |
| InChI | InChI=1S/C16H27F2NO3SSi/c1-16(2,3)24(4,5)22-9-8-19-23(20,21)15-7-6-13(11-17)10-14(15)12-18/h6-7,10,19H,8-9,11-12H2,1-5H3 |
| InChIKey | OVKYKGIUACAWAQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|