C14H15N3 — CID 155383232
3-phenyl-1-[(E)-pyrrolidin-2-ylidenemethyl]pyrazole (PubChem CID 155383232) has the molecular formula C14H15N3 and a molecular weight of 225.30 g/mol. Its IUPAC name is 3-phenyl-1-[(E)-pyrrolidin-2-ylidenemethyl]pyrazole.
| Compound Name | 3-phenyl-1-[(E)-pyrrolidin-2-ylidenemethyl]pyrazole |
|---|---|
| PubChem CID | 155383232 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-phenyl-1-[(E)-pyrrolidin-2-ylidenemethyl]pyrazole |
| SMILES | C(=C1\CCCN1)\n1ccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H15N3/c1-2-5-12(6-3-1)14-8-10-17(16-14)11-13-7-4-9-15-13/h1-3,5-6,8,10-11,15H,4,7,9H2/b13-11+ |
| InChIKey | RJYGXJBNJQSZME-ACCUITESSA-N |
| XLogP | 2.73 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |