C13H13N3O — CID 59751944
8-phenyl-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-5-one (PubChem CID 59751944) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 8-phenyl-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-5-one.
| Compound Name | 8-phenyl-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-5-one |
|---|---|
| PubChem CID | 59751944 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 8-phenyl-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-5-one |
| SMILES | O=c1[nH]nc(-c2ccccc2)c2c1CCCN2 |
| InChI | InChI=1S/C13H13N3O/c17-13-10-7-4-8-14-12(10)11(15-16-13)9-5-2-1-3-6-9/h1-3,5-6,14H,4,7-8H2,(H,16,17) |
| InChIKey | BBXLNRWLJMHSCH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |