C18H17ClF3N5O2 — CID 155385407
tert-butyl 3-[4-[6-chloro-5-cyano-4-(trifluoromethyl)-2-pyridinyl]pyrazol-1-yl]azetidine-1-carboxylate (PubChem CID 155385407) has the molecular formula C18H17ClF3N5O2 and a molecular weight of 427.81 g/mol. Its IUPAC name is tert-butyl 3-[4-[6-chloro-5-cyano-4-(trifluoromethyl)-2-pyridinyl]pyrazol-1-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[6-chloro-5-cyano-4-(trifluoromethyl)-2-pyridinyl]pyrazol-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 155385407 |
| Molecular Formula | C18H17ClF3N5O2 |
| Molecular Weight | 427.81 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | tert-butyl 3-[4-[6-chloro-5-cyano-4-(trifluoromethyl)-2-pyridinyl]pyrazol-1-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(n2cc(-c3cc(C(F)(F)F)c(C#N)c(Cl)n3)cn2)C1 |
| InChI | InChI=1S/C18H17ClF3N5O2/c1-17(2,3)29-16(28)26-8-11(9-26)27-7-10(6-24-27)14-4-13(18(20,21)22)12(5-23)15(19)25-14/h4,6-7,11H,8-9H2,1-3H3 |
| InChIKey | HOZGJHWZOJVGEU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 84.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|