C16H12F5N3O3S — CID 155386983
4-[[4-[4-(pentafluoro-λ6-sulfanyl)phenyl]phenyl]methoxy]-1H-triazole-5-carboxylic acid (PubChem CID 155386983) has the molecular formula C16H12F5N3O3S and a molecular weight of 421.35 g/mol. Its IUPAC name is 4-[[4-[4-(pentafluoro-λ6-sulfanyl)phenyl]phenyl]methoxy]-1H-triazole-5-carboxylic acid.
| Compound Name | 4-[[4-[4-(pentafluoro-λ6-sulfanyl)phenyl]phenyl]methoxy]-1H-triazole-5-carboxylic acid |
|---|---|
| PubChem CID | 155386983 |
| Molecular Formula | C16H12F5N3O3S |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 4-[[4-[4-(pentafluoro-λ6-sulfanyl)phenyl]phenyl]methoxy]-1H-triazole-5-carboxylic acid |
| SMILES | O=C(O)c1[nH]nnc1OCc1ccc(-c2ccc(S(F)(F)(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H12F5N3O3S/c17-28(18,19,20,21)13-7-5-12(6-8-13)11-3-1-10(2-4-11)9-27-15-14(16(25)26)22-24-23-15/h1-8H,9H2,(H,25,26)(H,22,23,24) |
| InChIKey | VGBWNQFFMKFROF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |