C10H8ClN3O3 — CID 139448954
4-[(4-chlorophenyl)methoxy]-1H-triazole-5-carboxylic acid (PubChem CID 139448954) has the molecular formula C10H8ClN3O3 and a molecular weight of 253.65 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methoxy]-1H-triazole-5-carboxylic acid.
| Compound Name | 4-[(4-chlorophenyl)methoxy]-1H-triazole-5-carboxylic acid |
|---|---|
| PubChem CID | 139448954 |
| Molecular Formula | C10H8ClN3O3 |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4-[(4-chlorophenyl)methoxy]-1H-triazole-5-carboxylic acid |
| SMILES | O=C(O)c1[nH]nnc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H8ClN3O3/c11-7-3-1-6(2-4-7)5-17-9-8(10(15)16)12-14-13-9/h1-4H,5H2,(H,15,16)(H,12,13,14) |
| InChIKey | NSKCMLICLRATAJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |