C16H17ClF4N2O4 — CID 155391663
[1-(4-chloro-3-fluorophenoxy)-2-oxo-2-(piperidin-4-ylmethylamino)ethyl] 2,2,2-trifluoroacetate (PubChem CID 155391663) has the molecular formula C16H17ClF4N2O4 and a molecular weight of 412.77 g/mol. Its IUPAC name is [1-(4-chloro-3-fluorophenoxy)-2-oxo-2-(piperidin-4-ylmethylamino)ethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-(4-chloro-3-fluorophenoxy)-2-oxo-2-(piperidin-4-ylmethylamino)ethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155391663 |
| Molecular Formula | C16H17ClF4N2O4 |
| Molecular Weight | 412.77 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | [1-(4-chloro-3-fluorophenoxy)-2-oxo-2-(piperidin-4-ylmethylamino)ethyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(NCC1CCNCC1)C(OC(=O)C(F)(F)F)Oc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C16H17ClF4N2O4/c17-11-2-1-10(7-12(11)18)26-14(27-15(25)16(19,20)21)13(24)23-8-9-3-5-22-6-4-9/h1-2,7,9,14,22H,3-6,8H2,(H,23,24) |
| InChIKey | QRTGNAIYMIAICC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.77 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|