C20H19F2N5O2 — CID 155391698
3-[[6-(4-amino-2,3-difluorophenyl)quinazolin-2-yl]amino]piperidine-1-carboxylic acid (PubChem CID 155391698) has the molecular formula C20H19F2N5O2 and a molecular weight of 399.40 g/mol. Its IUPAC name is 3-[[6-(4-amino-2,3-difluorophenyl)quinazolin-2-yl]amino]piperidine-1-carboxylic acid.
| Compound Name | 3-[[6-(4-amino-2,3-difluorophenyl)quinazolin-2-yl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155391698 |
| Molecular Formula | C20H19F2N5O2 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 3-[[6-(4-amino-2,3-difluorophenyl)quinazolin-2-yl]amino]piperidine-1-carboxylic acid |
| SMILES | Nc1ccc(-c2ccc3nc(NC4CCCN(C(=O)O)C4)ncc3c2)c(F)c1F |
| InChI | InChI=1S/C20H19F2N5O2/c21-17-14(4-5-15(23)18(17)22)11-3-6-16-12(8-11)9-24-19(26-16)25-13-2-1-7-27(10-13)20(28)29/h3-6,8-9,13H,1-2,7,10,23H2,(H,28,29)(H,24,25,26) |
| InChIKey | JKQRGNFAKBRVTE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|