C21H23F2N7O3 — CID 154976620
(3S,5S)-3-[[6-(4-amino-3-fluorophenyl)-7-oxo-8-propan-2-ylpteridin-2-yl]amino]-5-fluoropiperidine-1-carboxylic acid (PubChem CID 154976620) has the molecular formula C21H23F2N7O3 and a molecular weight of 459.46 g/mol. Its IUPAC name is (3S,5S)-3-[[6-(4-amino-3-fluorophenyl)-7-oxo-8-propan-2-ylpteridin-2-yl]amino]-5-fluoropiperidine-1-carboxylic acid.
| Compound Name | (3S,5S)-3-[[6-(4-amino-3-fluorophenyl)-7-oxo-8-propan-2-ylpteridin-2-yl]amino]-5-fluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154976620 |
| Molecular Formula | C21H23F2N7O3 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (3S,5S)-3-[[6-(4-amino-3-fluorophenyl)-7-oxo-8-propan-2-ylpteridin-2-yl]amino]-5-fluoropiperidine-1-carboxylic acid |
| SMILES | CC(C)n1c(=O)c(-c2ccc(N)c(F)c2)nc2cnc(N[C@H]3C[C@H](F)CN(C(=O)O)C3)nc21 |
| InChI | InChI=1S/C21H23F2N7O3/c1-10(2)30-18-16(27-17(19(30)31)11-3-4-15(24)14(23)5-11)7-25-20(28-18)26-13-6-12(22)8-29(9-13)21(32)33/h3-5,7,10,12-13H,6,8-9,24H2,1-2H3,(H,32,33)(H,25,26,28)/t12-,13-/m0/s1 |
| InChIKey | XUMQEXSBRILMJD-STQMWFEESA-N |
| XLogP | 2.66 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|