About 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide
3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide (PubChem CID 155393131) has the molecular formula C17H16N4O2S
and a molecular weight of 340.41 g/mol. Its IUPAC name is 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide.
Molecular Properties
| Compound Name | 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide |
| PubChem CID | 155393131 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide |
| SMILES | COc1cc(C(=O)NNSc2ccccc2)cc(-n2cccn2)c1 |
| InChI | InChI=1S/C17H16N4O2S/c1-23-15-11-13(10-14(12-15)21-9-5-8-18-21)17(22)19-20-24-16-6-3-2-4-7-16/h2-12,20H,1H3,(H,19,22) |
| InChIKey | UNEDHGWBDGDAER-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide?
The IUPAC name of 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide (CID 155393131) is 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide.
What is the SMILES notation for 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide?
The canonical SMILES for 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide is COc1cc(C(=O)NNSc2ccccc2)cc(-n2cccn2)c1.
What is the InChIKey of 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide?
The InChIKey is UNEDHGWBDGDAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O2S/c1-23-15-11-13(10-14(12-15)21-9-5-8-18-21)17(22)19-20-24-16-6-3-2-4-7-16/h2-12,20H,1H3,(H,19,22).
What are the key properties of 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide?
3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide has a molecular weight of 340.41 g/mol, XLogP of 2.82, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N'-phenylsulfanyl-5-pyrazol-1-ylbenzohydrazide is sourced from PubChem (CID 155393131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).