C17H20N2O3 — CID 155395768
N-[2-[4,5-dimethoxy-2-(pyridin-4-ylmethyl)phenyl]ethyl]formamide (PubChem CID 155395768) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[2-[4,5-dimethoxy-2-(pyridin-4-ylmethyl)phenyl]ethyl]formamide.
| Compound Name | N-[2-[4,5-dimethoxy-2-(pyridin-4-ylmethyl)phenyl]ethyl]formamide |
|---|---|
| PubChem CID | 155395768 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-[2-[4,5-dimethoxy-2-(pyridin-4-ylmethyl)phenyl]ethyl]formamide |
| SMILES | COc1cc(CCNC=O)c(Cc2ccncc2)cc1OC |
| InChI | InChI=1S/C17H20N2O3/c1-21-16-10-14(5-8-19-12-20)15(11-17(16)22-2)9-13-3-6-18-7-4-13/h3-4,6-7,10-12H,5,8-9H2,1-2H3,(H,19,20) |
| InChIKey | XDPXTQRDHFZOIW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|