C12H17NO3S — CID 155395771
6,7-dimethoxy-2-methylsulfinyl-3,4-dihydro-1H-isoquinoline (PubChem CID 155395771) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methylsulfinyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,7-dimethoxy-2-methylsulfinyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 155395771 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 6,7-dimethoxy-2-methylsulfinyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)CN(S(C)=O)CC2 |
| InChI | InChI=1S/C12H17NO3S/c1-15-11-6-9-4-5-13(17(3)14)8-10(9)7-12(11)16-2/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | FDOOTZLYFROWJR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |