C22H23FN2O2 — CID 155397639
[(3R,4S)-4-ethenylpyrrolidin-3-yl] (1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 155397639) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is [(3R,4S)-4-ethenylpyrrolidin-3-yl] (1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | [(3R,4S)-4-ethenylpyrrolidin-3-yl] (1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 155397639 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [(3R,4S)-4-ethenylpyrrolidin-3-yl] (1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C=C[C@H]1CNC[C@@H]1OC(=O)N1CCc2ccccc2[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN2O2/c1-2-15-13-24-14-20(15)27-22(26)25-12-11-16-5-3-4-6-19(16)21(25)17-7-9-18(23)10-8-17/h2-10,15,20-21,24H,1,11-14H2/t15-,20-,21-/m0/s1 |
| InChIKey | ACYDCCSFDFIIEV-JHVJFLLYSA-N |
| XLogP | 3.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|