C17H29N3O3 — CID 155402352
4-methyl-4-[3-methyl-3-[4-(3-oxobutyl)triazol-1-yl]butoxy]pentan-2-one (PubChem CID 155402352) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-methyl-4-[3-methyl-3-[4-(3-oxobutyl)triazol-1-yl]butoxy]pentan-2-one.
| Compound Name | 4-methyl-4-[3-methyl-3-[4-(3-oxobutyl)triazol-1-yl]butoxy]pentan-2-one |
|---|---|
| PubChem CID | 155402352 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 4-methyl-4-[3-methyl-3-[4-(3-oxobutyl)triazol-1-yl]butoxy]pentan-2-one |
| SMILES | CC(=O)CCc1cn(C(C)(C)CCOC(C)(C)CC(C)=O)nn1 |
| InChI | InChI=1S/C17H29N3O3/c1-13(21)7-8-15-12-20(19-18-15)16(3,4)9-10-23-17(5,6)11-14(2)22/h12H,7-11H2,1-6H3 |
| InChIKey | IVZHPMFUDAHHCY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |