C16H31N3 — CID 130295953
4-(5,5-dimethylhexyl)-1-(2-methylpentan-2-yl)triazole (PubChem CID 130295953) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is 4-(5,5-dimethylhexyl)-1-(2-methylpentan-2-yl)triazole.
| Compound Name | 4-(5,5-dimethylhexyl)-1-(2-methylpentan-2-yl)triazole |
|---|---|
| PubChem CID | 130295953 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 4-(5,5-dimethylhexyl)-1-(2-methylpentan-2-yl)triazole |
| SMILES | CCCC(C)(C)n1cc(CCCCC(C)(C)C)nn1 |
| InChI | InChI=1S/C16H31N3/c1-7-11-16(5,6)19-13-14(17-18-19)10-8-9-12-15(2,3)4/h13H,7-12H2,1-6H3 |
| InChIKey | INDAHHYSGVSMSJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|