C21H17ClF6N2O3 — CID 155402428
2-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-methoxyethoxy)-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenol (PubChem CID 155402428) has the molecular formula C21H17ClF6N2O3 and a molecular weight of 494.82 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-methoxyethoxy)-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenol.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-methoxyethoxy)-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 155402428 |
| Molecular Formula | C21H17ClF6N2O3 |
| Molecular Weight | 494.82 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2-methoxyethoxy)-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenol |
| SMILES | COCCOc1ccc(-c2cc(C(F)(F)F)nn2C)c(O)c1-c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17ClF6N2O3/c1-30-15(10-17(29-30)21(26,27)28)12-4-6-16(33-8-7-32-2)18(19(12)31)11-3-5-14(22)13(9-11)20(23,24)25/h3-6,9-10,31H,7-8H2,1-2H3 |
| InChIKey | UQILXCSKGAGPAY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.82 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|