C14H20N2 — CID 155404109
3-tert-butyl-2-propan-2-yl-1H-pyrrolo[2,3-c]pyridine (PubChem CID 155404109) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 3-tert-butyl-2-propan-2-yl-1H-pyrrolo[2,3-c]pyridine.
| Compound Name | 3-tert-butyl-2-propan-2-yl-1H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 155404109 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-tert-butyl-2-propan-2-yl-1H-pyrrolo[2,3-c]pyridine |
| SMILES | CC(C)c1[nH]c2cnccc2c1C(C)(C)C |
| InChI | InChI=1S/C14H20N2/c1-9(2)13-12(14(3,4)5)10-6-7-15-8-11(10)16-13/h6-9,16H,1-5H3 |
| InChIKey | GOKADLAJPGZVBN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |