C15H25N3OS — CID 155405069
S-methyl 3-[3-(4-propan-2-ylpyrazol-1-yl)piperidin-1-yl]propanethioate (PubChem CID 155405069) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is S-methyl 3-[3-(4-propan-2-ylpyrazol-1-yl)piperidin-1-yl]propanethioate.
| Compound Name | S-methyl 3-[3-(4-propan-2-ylpyrazol-1-yl)piperidin-1-yl]propanethioate |
|---|---|
| PubChem CID | 155405069 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | S-methyl 3-[3-(4-propan-2-ylpyrazol-1-yl)piperidin-1-yl]propanethioate |
| SMILES | CSC(=O)CCN1CCCC(n2cc(C(C)C)cn2)C1 |
| InChI | InChI=1S/C15H25N3OS/c1-12(2)13-9-16-18(10-13)14-5-4-7-17(11-14)8-6-15(19)20-3/h9-10,12,14H,4-8,11H2,1-3H3 |
| InChIKey | LXZFTOUPXYQARA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|